From Real Exams Quiz

A Level H2 Chemistry Kinetics Equilibrium Quiz

Free Exam-Derived Qwen3.6 Plus A Level H2 Chemistry Kinetics Equilibrium quiz with questions and answers for Singapore students. This page is rendered as a direct URL so the questions and answers can be discovered without pressing in-page buttons.

These static practice materials are generated from the site's syllabus and paper-generation workflow, with source and model context shown so students and parents can evaluate the material before use.

A Level H2 Chemistry From Real Exams Generated by Qwen3.6 Plus Updated 2026-06-03

Questions

<!-- TuitionGoWhere generation metadata: stage=3-0; model=qwen/qwen3.6-plus; model_label=Qwen3.6 Plus; generated=2026-05-27; Sources: Stage 2-1 real exam-derived templates and Stage 2-2 exam-enriched syllabus. -->

A-Level Chemistry H2 Quiz - Kinetics Equilibrium

Name: __________________________
Class: __________________________
Date: __________________________
Score: _______ / 40

Duration: 60 minutes
Total Marks: 40
Instructions:

  1. Answer all questions.
  2. Write your answers in the spaces provided.
  3. You may use a scientific calculator.
  4. The Data Booklet is relevant to some questions.

Section A: Multiple Choice & Short Concepts (Questions 1-5)

1. Which of the following statements correctly describes the effect of a catalyst on the equilibrium constant, KcK_c, and the rate of reaction?
[1]
A. KcK_c increases; Rate increases
B. KcK_c remains unchanged; Rate increases
C. KcK_c decreases; Rate decreases
D. KcK_c remains unchanged; Rate remains unchanged

2. For the reaction 2NO2(g)N2O4(g)2NO_2(g) \rightleftharpoons N_2O_4(g), ΔH<0\Delta H < 0. Which change will increase the value of the equilibrium constant KcK_c?
[1]
A. Increasing the pressure
B. Decreasing the pressure
C. Increasing the temperature
D. Decreasing the temperature

3. The rate equation for a reaction is given by: Rate =k[A][B]2= k[A][B]^2.
If the concentration of AA is doubled and the concentration of BB is halved, what is the effect on the initial rate?
[1]
A. The rate is halved.
B. The rate remains unchanged.
C. The rate doubles.
D. The rate quadruples.

4. Consider the equilibrium: H2(g)+I2(g)2HI(g)H_2(g) + I_2(g) \rightleftharpoons 2HI(g).
At equilibrium, the partial pressures are p(H2)=0.20p(H_2) = 0.20 atm, p(I2)=0.20p(I_2) = 0.20 atm, and p(HI)=0.80p(HI) = 0.80 atm.
Calculate the value of KpK_p.
[1]
A. 4
B. 16
C. 20
D. 80

5. A student plots lnk\ln k against 1/T1/T for a reaction and obtains a straight line with a gradient of 5000-5000 K.
Given R=8.31R = 8.31 J mol1^{-1} K1^{-1}, calculate the activation energy, EaE_a, in kJ mol1^{-1}.
[1]
A. 4.16
B. 41.6
C. 602
D. 5000


Section B: Kinetics Concepts (Questions 6-10)

6. Explain why increasing the temperature increases the rate of a reaction, referring to the Maxwell-Boltzmann distribution.
[2]




7. Define the term half-life of a reaction.
[1]



8. State the units of the rate constant, kk, for a second-order reaction where Rate =k[A]2= k[A]^2.
[1]


9. For the equilibrium N2O4(g)2NO2(g)N_2O_4(g) \rightleftharpoons 2NO_2(g), explain the effect of adding an inert gas at constant volume on the position of equilibrium.
[1]



10. Distinguish between the order of reaction with respect to a reactant and the stoichiometric coefficient of that reactant in the balanced equation.
[1]




Section C: Structured Questions - Kinetics (Questions 11-15)

11. The reaction between propanone and iodine in acidic solution is represented by the equation:
CH3COCH3(aq)+I2(aq)H+CH3COCH2I(aq)+H+(aq)+I(aq)CH_3COCH_3(aq) + I_2(aq) \xrightarrow{H^+} CH_3COCH_2I(aq) + H^+(aq) + I^-(aq)

The following initial rate data were obtained at constant temperature:

Experiment[CH3COCH3][CH_3COCH_3] / mol dm3^{-3}[I2][I_2] / mol dm3^{-3}[H+][H^+] / mol dm3^{-3}Initial Rate / mol dm3^{-3} s1^{-1}
10.100.100.102.0×1052.0 \times 10^{-5}
20.200.100.104.0×1054.0 \times 10^{-5}
30.100.200.102.0×1052.0 \times 10^{-5}
40.100.100.204.0×1054.0 \times 10^{-5}

Deduce the order of reaction with respect to Propanone, CH3COCH3CH_3COCH_3.
[1]


12. Using the data in Question 11, deduce the order of reaction with respect to Iodine, I2I_2.
[1]


13. Using the data in Question 11, deduce the order of reaction with respect to Hydrogen ions, H+H^+.
[1]


14. Write the rate equation for this reaction and calculate the value of the rate constant, kk, including its units.
[4]
<br> <br> <br> <br> <br> <br>

15. A proposed mechanism for this reaction is:
Step 1: CH3COCH3+H+CH3C(OH+)CH3CH_3COCH_3 + H^+ \rightleftharpoons CH_3C(OH^+)CH_3 (fast equilibrium)
Step 2: CH3C(OH+)CH3CH3C(OH)=CH2+H+CH_3C(OH^+)CH_3 \rightarrow CH_3C(OH)=CH_2 + H^+ (slow)
Step 3: CH3C(OH)=CH2+I2CH3COCH2I+H++ICH_3C(OH)=CH_2 + I_2 \rightarrow CH_3COCH_2I + H^+ + I^- (fast)

Explain whether this mechanism is consistent with the rate equation you derived in Question 14.
[2]






Section D: Structured Questions - Equilibrium (Questions 16-20)

16. Methanol is manufactured industrially by the reaction of carbon monoxide and hydrogen:
CO(g)+2H2(g)CH3OH(g)ΔH=91 kJ mol1CO(g) + 2H_2(g) \rightleftharpoons CH_3OH(g) \quad \Delta H = -91 \text{ kJ mol}^{-1}

Write the expression for the equilibrium constant, KpK_p, for this reaction.
[1]


17. In a specific experiment, 1.00 mol of COCO and 2.00 mol of H2H_2 were placed in a closed vessel. At equilibrium, at a total pressure of 10.0 atm, 0.40 mol of CH3OHCH_3OH was present.
Calculate the amount, in moles, of COCO and H2H_2 present at equilibrium.
[2]
<br> <br>

18. Using the equilibrium amounts from Question 17, calculate the mole fraction and partial pressure of each gas at equilibrium.
[4]
<br> <br> <br> <br> <br> <br>

19. Calculate the value of KpK_p for this equilibrium and state its units.
[3]
<br> <br> <br> <br> <br> <br>

20. The manufacturer operates the process at 500 K and 100 atm.
(a) Explain why a lower temperature is not used, despite the forward reaction being exothermic.
(b) If the volume of the vessel is halved at constant temperature, state and explain the effect on the yield of methanol.
[3]






Answers

<!-- TuitionGoWhere generation metadata: stage=3-0; model=qwen/qwen3.6-plus; model_label=Qwen3.6 Plus; generated=2026-05-27; Sources: Stage 2-1 real exam-derived templates and Stage 2-2 exam-enriched syllabus. -->

A-Level Chemistry H2 Quiz Answers - Kinetics Equilibrium

1. B
Catalysts lower activation energy, increasing rate, but do not affect thermodynamics (KcK_c).

2. D
Reaction is exothermic (ΔH<0\Delta H < 0). Decreasing T shifts equilibrium to the right (products), increasing KcK_c.

3. A
Rate [A][B]2\propto [A][B]^2. New Rate (2[A])(0.5[B])2=2×0.25×[A][B]2=0.5×\propto (2[A])(0.5[B])^2 = 2 \times 0.25 \times [A][B]^2 = 0.5 \times Original Rate.

4. B
Kp=p(HI)2p(H2)p(I2)=0.8020.20×0.20=0.640.04=16K_p = \frac{p(HI)^2}{p(H_2)p(I_2)} = \frac{0.80^2}{0.20 \times 0.20} = \frac{0.64}{0.04} = 16.

5. B
Gradient =Ea/R= -E_a/R. 5000=Ea/8.31Ea=5000×8.31=41550-5000 = -E_a/8.31 \Rightarrow E_a = 5000 \times 8.31 = 41550 J mol1=41.6^{-1} = 41.6 kJ mol1^{-1}.

6.

  • Increasing temperature increases the average kinetic energy of particles. [1]
  • A larger proportion of particles have energy greater than or equal to the activation energy (EEaE \ge E_a), leading to more frequent successful collisions. [1]

7.
The time taken for the concentration of a reactant to decrease to half of its initial value. [1]

8.
mol1^{-1} dm3^3 s1^{-1} [1]
(Rate is mol dm3^{-3} s1^{-1}, [A]2[A]^2 is mol2^2 dm6^{-6}. k=Rate/[A]2k = \text{Rate}/[A]^2)

9.
No effect. [1]
Adding inert gas at constant volume does not change the partial pressures of the reacting gases, so the position of equilibrium remains unchanged.

10.
Order of reaction is determined experimentally from rate data, whereas stoichiometric coefficient is from the balanced chemical equation. They are only equal if the reaction is elementary. [1]

11.
1 (Doubling [Propanone] doubles rate) [1]

12.
0 (Doubling [Iodine] has no effect on rate) [1]

13.
1 (Doubling [H+] doubles rate) [1]

14.
Rate =k[CH3COCH3][H+]= k[CH_3COCH_3][H^+] [1]
k=Rate[CH3COCH3][H+]k = \frac{\text{Rate}}{[CH_3COCH_3][H^+]}
k=2.0×1050.10×0.10=2.0×1050.01=2.0×103k = \frac{2.0 \times 10^{-5}}{0.10 \times 0.10} = \frac{2.0 \times 10^{-5}}{0.01} = 2.0 \times 10^{-3} [1 for value]
Units: mol dm3s1(mol dm3)(mol dm3)=mol1dm3s1\frac{\text{mol dm}^{-3} \text{s}^{-1}}{(\text{mol dm}^{-3})(\text{mol dm}^{-3})} = \text{mol}^{-1} \text{dm}^3 \text{s}^{-1} [1 for units]
Answer: 2.0×103 mol1dm3s12.0 \times 10^{-3} \text{ mol}^{-1} \text{dm}^3 \text{s}^{-1} [1 for final answer with units]

15.
The rate equation depends on [CH3COCH3][CH_3COCH_3] and [H+][H^+]. Step 2 is the rate-determining step (slow step). The reactants in Step 2 are derived from Propanone and H+ (via Step 1 equilibrium). Iodine is involved in Step 3 (fast), which is after the RDS, so it does not appear in the rate equation. This is consistent. [2]

16.
Kp=p(CH3OH)p(CO)p(H2)2K_p = \frac{p(CH_3OH)}{p(CO) \cdot p(H_2)^2} [1]

17.
Moles CH3OHCH_3OH formed = 0.40
Moles COCO reacted = 0.40 \Rightarrow Equil CO=1.000.40=0.60CO = 1.00 - 0.40 = 0.60 mol [1]
Moles H2H_2 reacted = 2×0.40=0.802 \times 0.40 = 0.80 \Rightarrow Equil H2=2.000.80=1.20H_2 = 2.00 - 0.80 = 1.20 mol [1]

18.
Total moles at equilibrium = 0.60+1.20+0.40=2.200.60 + 1.20 + 0.40 = 2.20 mol
Mole fraction CO=0.60/2.20=0.273CO = 0.60 / 2.20 = 0.273 [0.5]
Mole fraction H2=1.20/2.20=0.545H_2 = 1.20 / 2.20 = 0.545 [0.5]
Mole fraction CH3OH=0.40/2.20=0.182CH_3OH = 0.40 / 2.20 = 0.182 [0.5]
Partial Pressure = Mole Fraction ×\times Total Pressure (10.0 atm)
p(CO)=0.2727×10.0=2.73p(CO) = 0.2727 \times 10.0 = 2.73 atm [0.5]
p(H2)=0.5454×10.0=5.45p(H_2) = 0.5454 \times 10.0 = 5.45 atm [0.5]
p(CH3OH)=0.1818×10.0=1.82p(CH_3OH) = 0.1818 \times 10.0 = 1.82 atm [0.5]
[1 for correct set of mole fractions, 1 for correct set of partial pressures]

19.
Kp=1.818(2.727)(5.454)2K_p = \frac{1.818}{(2.727)(5.454)^2}
Kp=1.8182.727×29.75=1.81881.13=0.0224K_p = \frac{1.818}{2.727 \times 29.75} = \frac{1.818}{81.13} = 0.0224 [2 for calculation]
Units: atmatmatm2=atm2\frac{\text{atm}}{\text{atm} \cdot \text{atm}^2} = \text{atm}^{-2} [1 for units]

20.
(a) At lower temperatures, the rate of reaction is too slow to be economically viable / equilibrium is reached too slowly. [1]
(b) Yield increases. Halving volume increases pressure. Equilibrium shifts to side with fewer moles of gas (RHS: 1 mol vs LHS: 3 mol) to oppose change. [2]